CAS 115812-96-9 appears in our catalog under these names: 4-Fluoro-3-nitropyridine, 95%, 4-Fluoro-3-nitropyridine, 98%, 4-Fluoro-3-nitropyridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 10mg, 25mg, 50mg.
4-fluoro-3-nitropyridine (CAS 115812-96-9) is a chemical compound with the molecular formula C5H3FN2O2 and a molecular weight of 142.09 g/mol. IUPAC name: 4-fluoro-3-nitropyridine. InChIKey: ITEDEJJEXBFZGM-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O2 |
|---|---|
| Molecular weight | 142.09 g/mol |
| IUPAC name | 4-fluoro-3-nitropyridine |
| InChIKey | ITEDEJJEXBFZGM-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)