cas: 2096335-83-8 — see every product listed under this CAS number, including other names
2-Fluoro-5-(piperidinomethyl)phenylboronic acid, pinacol ester, 96%, 96% (CAS 2096335-83-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHJ1-1g |
| cas | 2096335-83-8 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 712.40 Pln | |
| Chemat | 250mg | 304.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine (CAS 2096335-83-8) is a chemical compound with the molecular formula C18H27BFNO2 and a molecular weight of 319.2 g/mol. IUPAC name: 1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine. InChIKey: JDWFQYQIINHLIC-UHFFFAOYSA-N.
| Molecular formula | C18H27BFNO2 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine |
| InChIKey | JDWFQYQIINHLIC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CN3CCCCC3)F |
Computed by PubChem (NCBI)