CAS 2377608-45-0 is the registry number for 3-Fluoro-4-(piperidinomethyl)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine (CAS 2377608-45-0) is a chemical compound with the molecular formula C18H27BFNO2 and a molecular weight of 319.2 g/mol. IUPAC name: 1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine. InChIKey: WXUCVCPBEXXWQA-UHFFFAOYSA-N.
| Molecular formula | C18H27BFNO2 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine |
| InChIKey | WXUCVCPBEXXWQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CN3CCCCC3)F |
Computed by PubChem (NCBI)