Products 2377611-14-6
CAS 2377611-14-6 is the registry number for 4-Fluoro-3-piperidinomethylphenylboronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine (CAS 2377611-14-6) is a chemical compound with the molecular formula C18H27BFNO2 and a molecular weight of 319.2 g/mol. IUPAC name: 1-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine. InChIKey: GTPAMTPXCIQFKL-UHFFFAOYSA-N.
| Molecular formula | C18H27BFNO2 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 1-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine |
| InChIKey | GTPAMTPXCIQFKL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)CN3CCCCC3 |
Computed by PubChem (NCBI)