cas: 454-15-9 — see every product listed under this CAS number, including other names
2-Fluoro-5-nitrobenzyl bromide, 98% (CAS 454-15-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044646-5G |
| cas | 454-15-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 25g | 2070.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(bromomethyl)-1-fluoro-4-nitrobenzene (CAS 454-15-9) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-(bromomethyl)-1-fluoro-4-nitrobenzene. InChIKey: KQAKOKGCKNKARC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-(bromomethyl)-1-fluoro-4-nitrobenzene |
| InChIKey | KQAKOKGCKNKARC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CBr)F |
Computed by PubChem (NCBI)