cas: 425378-68-3 — see every product listed under this CAS number, including other names
2-Fluoro-5-nitrophenylboronic acid pinacol ester, 97% (CAS 425378-68-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078881-5G |
| cas | 425378-68-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 25g | 502.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 425378-68-3) is a chemical compound with the molecular formula C12H15BFNO4 and a molecular weight of 267.06 g/mol. IUPAC name: 2-(2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FXEVKZIXXGDLFW-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO4 |
|---|---|
| Molecular weight | 267.06 g/mol |
| IUPAC name | 2-(2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FXEVKZIXXGDLFW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)