cas: 16855-08-6 — see every product listed under this CAS number, including other names
2-HYDROXY-6-NITROBENZALDEHYDE, 97% (CAS 16855-08-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F829586-100MG |
| cas | 16855-08-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 544.62 Pln | |
| Fluorochem | 1g | 1325.59 Pln | |
| Fluorochem | 5g | 4595.27 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-hydroxy-6-nitrobenzaldehyde (CAS 16855-08-6) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 2-hydroxy-6-nitrobenzaldehyde. InChIKey: RYWYLFSBHZEAJD-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 2-hydroxy-6-nitrobenzaldehyde |
| InChIKey | RYWYLFSBHZEAJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)