Products 138946-42-6
CAS 138946-42-6 appears in our catalog under these names: 2,3-Pyridinedicarboxylic Acid-d3, Quinolinic-4,5,6-d3 acid, 98 atom % D, min 98% Chemical Purity, 2,3-Pyridinedicarboxylic Acid-d3 (Major), >95% (HPLC), Quinolinic acid–d3, Quinolinic acid-d3, 99.90%. Offered by: Chemat Brand, CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 0,01g, 0,005g, 10mg, 1mg, 5 mg, 1 mg.
4,5,6-trideuteriopyridine-2,3-dicarboxylic acid (CAS 138946-42-6) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 170.14 g/mol. IUPAC name: 4,5,6-trideuteriopyridine-2,3-dicarboxylic acid. InChIKey: GJAWHXHKYYXBSV-CBYSEHNBSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 4,5,6-trideuteriopyridine-2,3-dicarboxylic acid |
| InChIKey | GJAWHXHKYYXBSV-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])C(=O)O)C(=O)O)[2H] |
Computed by PubChem (NCBI)