cas: 1049744-89-9 — see every product listed under this CAS number, including other names
2-Hydrazineyl-5-(trifluoromethyl)pyridine hydrochloride 95% (CAS 1049744-89-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100254-250mg |
| cas | 1049744-89-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 759.75 Pln | |
| Ambeed | 25g | 1766.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100254 |
[5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride (CAS 1049744-89-9) is a chemical compound with the molecular formula C6H7ClF3N3 and a molecular weight of 213.59 g/mol. IUPAC name: [5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride. InChIKey: LCEPARDLEACIDZ-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3N3 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | [5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride |
| InChIKey | LCEPARDLEACIDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)