cas: 1049744-89-9 — see every product listed under this CAS number, including other names
2-Hydrazino-5-(trifluoromethyl)pyridine, HCl, 95%, 95% (CAS 1049744-89-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HAIR-250mg |
| cas | 1049744-89-9 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 25g | 1523.60 Pln | |
| Chemat | 10g | 731.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride (CAS 1049744-89-9) is a chemical compound with the molecular formula C6H7ClF3N3 and a molecular weight of 213.59 g/mol. IUPAC name: [5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride. InChIKey: LCEPARDLEACIDZ-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3N3 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | [5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride |
| InChIKey | LCEPARDLEACIDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)