cas: 1049744-89-9 — see every product listed under this CAS number, including other names
2-Hydrazino-5-(trifluoromethyl)pyridine, HCl (CAS 1049744-89-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F540221-250MG |
| cas | 1049744-89-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 25g | 2887.54 Pln |
| delivery time | 3-4 weeks |
|---|
[5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride (CAS 1049744-89-9) is a chemical compound with the molecular formula C6H7ClF3N3 and a molecular weight of 213.59 g/mol. IUPAC name: [5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride. InChIKey: LCEPARDLEACIDZ-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3N3 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | [5-(trifluoromethyl)-2-pyridinyl]hydrazine;hydrochloride |
| InChIKey | LCEPARDLEACIDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)