cas: 15793-77-8 — see every product listed under this CAS number, including other names
2-Hydrazinoquinoline, 98% (CAS 15793-77-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F145900-1G |
| cas | 15793-77-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 471.73 Pln | |
| Fluorochem | 10g | 846.59 Pln | |
| Fluorochem | 25g | 1955.58 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Quinolin-2-ylhydrazine (CAS 15793-77-8) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: quinolin-2-ylhydrazine. InChIKey: QMVCLSHKMIGEFN-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | quinolin-2-ylhydrazine |
| InChIKey | QMVCLSHKMIGEFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)NN |
Computed by PubChem (NCBI)