2-Hydrazinylquinoline, 98%
cas: 15793-77-8 — see every product listed under this CAS number, including other names
2-Hydrazinylquinoline, 98% (CAS 15793-77-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | PY-1948-10g |
| cas | 15793-77-8 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1977.94 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 606.80 Pln | |
| Chemat | 25g | 1389.20 Pln | |
| BLDpharm | 100mg | 225.50 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 319.91 Pln | |
| BLDpharm | 5g | 519.84 Pln | |
| BLDpharm | 25g | 2130.39 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Quinolin-2-ylhydrazine (CAS 15793-77-8) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: quinolin-2-ylhydrazine. InChIKey: QMVCLSHKMIGEFN-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | quinolin-2-ylhydrazine |
| InChIKey | QMVCLSHKMIGEFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)NN |
Computed by PubChem (NCBI)