CAS 15793-77-8 appears in our catalog under these names: 2-Hydrazinylquinoline, 98%, 2–Hydrazinoquinoline, 2-Hydrazinoquinoline, 97% , 2-Hydrazinoquinoline, >98.0%(HPLC)(T), 2-Hydrazinoquinoline. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
Quinolin-2-ylhydrazine (CAS 15793-77-8) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: quinolin-2-ylhydrazine. InChIKey: QMVCLSHKMIGEFN-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | quinolin-2-ylhydrazine |
| InChIKey | QMVCLSHKMIGEFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)NN |
Computed by PubChem (NCBI)