cas: 6343-98-2 — see every product listed under this CAS number, including other names
2-Hydrazinyl-5-nitropyridine, 95%, 95% (CAS 6343-98-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EEAP-100mg |
| cas | 6343-98-2 |
| size | 100mg |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 25g | 578.00 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 50g | 750.80 Pln | |
| Chemat | 100g | 1302.80 Pln | |
| Chemat | 250g | 2334.80 Pln | |
| Chemat | 500g | 4060.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(5-nitro-2-pyridinyl)hydrazine (CAS 6343-98-2) is a chemical compound with the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. IUPAC name: (5-nitro-2-pyridinyl)hydrazine. InChIKey: DDWAPSXNXHYQLK-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O2 |
|---|---|
| Molecular weight | 154.13 g/mol |
| IUPAC name | (5-nitro-2-pyridinyl)hydrazine |
| InChIKey | DDWAPSXNXHYQLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])NN |
Computed by PubChem (NCBI)