CAS 371201-70-6 is the registry number for 1-Allyl-3-nitro-1H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-nitro-1-prop-2-enyl-1,2,4-triazole (CAS 371201-70-6) is a chemical compound with the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. IUPAC name: 3-nitro-1-prop-2-enyl-1,2,4-triazole. InChIKey: AQGYMMZKWNUSKM-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O2 |
|---|---|
| Molecular weight | 154.13 g/mol |
| IUPAC name | 3-nitro-1-prop-2-enyl-1,2,4-triazole |
| InChIKey | AQGYMMZKWNUSKM-UHFFFAOYSA-N |
| SMILES | C=CCN1C=NC(=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)