CAS 15763-11-8 appears in our catalog under these names: Regadenoson Impurity 19, 2-Hydrazino Adenosine, >95% (HPLC), 2–Hydrazino Adenosine, 2-Hydrazino-adenosine, 95%, 95%, 2-Hydrazinyl-adenosine. Offered by: Chemat Brand, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 250mg, 500mg, 50mg, 1g, 5g, 100mg, 1 g.
(2R,3R,4S,5R)-2-(6-amino-2-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 15763-11-8) is a chemical compound with the molecular formula C10H15N7O4 and a molecular weight of 297.27 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-2-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: BAYFDGKAUSOEIS-UUOKFMHZSA-N.
| Molecular formula | C10H15N7O4 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-2-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | BAYFDGKAUSOEIS-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)NN)N |
Computed by PubChem (NCBI)