cas: 58914-34-4 — see every product listed under this CAS number, including other names
2-Hydroxy-4-(trifluoromethyl)benzaldehyde, 95% (CAS 58914-34-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 50g, 100g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QC-5041-5g |
| cas | 58914-34-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 1013.20 Pln | |
| Fluorochem | 10g | 1965.99 Pln | |
| Fluorochem | 25g | 3007.29 Pln | |
| Fluorochem | 50g | 4782.71 Pln | |
| Fluorochem | 100g | 7854.54 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-hydroxy-4-(trifluoromethyl)benzaldehyde (CAS 58914-34-4) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2-hydroxy-4-(trifluoromethyl)benzaldehyde. InChIKey: YHYNJGHMBMXAFB-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2-hydroxy-4-(trifluoromethyl)benzaldehyde |
| InChIKey | YHYNJGHMBMXAFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)C=O |
Computed by PubChem (NCBI)