Products 773873-67-9

CAS 773873-67-9 is the registry number for Methyl 2,3,6-trifluorobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,3,6-trifluorobenzoate (CAS 773873-67-9) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: methyl 2,3,6-trifluorobenzoate. InChIKey: YPJBTQSRHVPURE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3O2
Molecular weight190.12 g/mol
IUPAC namemethyl 2,3,6-trifluorobenzoate
InChIKeyYPJBTQSRHVPURE-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1F)F)F

Computed by PubChem (NCBI)