CAS 773873-67-9 is the registry number for Methyl 2,3,6-trifluorobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
Methyl 2,3,6-trifluorobenzoate (CAS 773873-67-9) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: methyl 2,3,6-trifluorobenzoate. InChIKey: YPJBTQSRHVPURE-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | methyl 2,3,6-trifluorobenzoate |
| InChIKey | YPJBTQSRHVPURE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)F)F |
Computed by PubChem (NCBI)