cas: 3264-10-6 — see every product listed under this CAS number, including other names
2-Hydroxy-5-nitropyrimidine, 95% (CAS 3264-10-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076081-1G |
| cas | 3264-10-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 716.43 Pln | |
| Fluorochem | 100g | 2689.70 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-nitro-1H-pyrimidin-2-one (CAS 3264-10-6) is a chemical compound with the molecular formula C4H3N3O3 and a molecular weight of 141.09 g/mol. IUPAC name: 5-nitro-1H-pyrimidin-2-one. InChIKey: ZNNRVSOVVLYQBV-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O3 |
|---|---|
| Molecular weight | 141.09 g/mol |
| IUPAC name | 5-nitro-1H-pyrimidin-2-one |
| InChIKey | ZNNRVSOVVLYQBV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)