cas: 116548-03-9 — see every product listed under this CAS number, including other names
2-Hydroxy-6-(trifluoromethyl)nicotinamide (CAS 116548-03-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 2g, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009267-250MG |
| cas | 116548-03-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 500mg | 331.15 Pln | |
| Fluorochem | 2g | 690.40 Pln | |
| Fluorochem | 1g | 653.95 Pln | |
| Fluorochem | 5g | 1591.12 Pln | |
| Fluorochem | 25g | 5324.18 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (CAS 116548-03-9) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide. InChIKey: BZMWJLRKOIRLSU-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| InChIKey | BZMWJLRKOIRLSU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1)C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)