cas: 30988-90-0 — see every product listed under this CAS number, including other names
2-Hydroxy-N,N-dimethylbenzenesulfonamide 96% (CAS 30988-90-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A798029-100mg |
| cas | 30988-90-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1354.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A798029 |
2-hydroxy-N,N-dimethylbenzenesulfonamide (CAS 30988-90-0) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-hydroxy-N,N-dimethylbenzenesulfonamide. InChIKey: WCOFHDMOGJGUTB-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-hydroxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | WCOFHDMOGJGUTB-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1O |
Computed by PubChem (NCBI)