CAS 7010-86-8 appears in our catalog under these names: 4-Methoxy-n-methylbenzenesulfonamide, 95%, 4-Methoxy-N-methylbenzenesulfonamide, 95+%, 4-Methoxy-N-methylbenzenesulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 2g.
4-methoxy-N-methylbenzenesulfonamide (CAS 7010-86-8) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 4-methoxy-N-methylbenzenesulfonamide. InChIKey: UIVZZDAOKBAWCS-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 4-methoxy-N-methylbenzenesulfonamide |
| InChIKey | UIVZZDAOKBAWCS-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)