CAS 3271-43-0 is the registry number for N-Ethyl-4-hydroxybenzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-ethyl-4-hydroxybenzenesulfonamide (CAS 3271-43-0) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: N-ethyl-4-hydroxybenzenesulfonamide. InChIKey: HWQXFAHQCSOYTN-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | N-ethyl-4-hydroxybenzenesulfonamide |
| InChIKey | HWQXFAHQCSOYTN-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)