cas: 249285-50-5 — see every product listed under this CAS number, including other names
2-Hydroxyethyl benzenesulfonate 95% (CAS 249285-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984306-100mg |
| cas | 249285-50-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 731.94 Pln | |
| Ambeed | 250mg | 1060.12 Pln | |
| Ambeed | 1g | 2556.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A984306 |
2-hydroxyethyl benzenesulfonate (CAS 249285-50-5) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: 2-hydroxyethyl benzenesulfonate. InChIKey: BJFRCYIYQLHUDS-UHFFFAOYSA-N.
| Molecular formula | C8H10O4S |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 2-hydroxyethyl benzenesulfonate |
| InChIKey | BJFRCYIYQLHUDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OCCO |
Computed by PubChem (NCBI)