cas: 249285-50-5 — see every product listed under this CAS number, including other names
Benzenesulfonic acid 2-hydroxy-ethyl ester, 95%, 95% (CAS 249285-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PW3-100mg |
| cas | 249285-50-5 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 894.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-hydroxyethyl benzenesulfonate (CAS 249285-50-5) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: 2-hydroxyethyl benzenesulfonate. InChIKey: BJFRCYIYQLHUDS-UHFFFAOYSA-N.
| Molecular formula | C8H10O4S |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 2-hydroxyethyl benzenesulfonate |
| InChIKey | BJFRCYIYQLHUDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OCCO |
Computed by PubChem (NCBI)