cas: 364-77-2 — see every product listed under this CAS number, including other names
2-Iodo-5-fluoronitrobenzene, 98%, 98% (CAS 364-77-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MQS-1g |
| cas | 364-77-2 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 338.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-fluoro-1-iodo-2-nitrobenzene (CAS 364-77-2) is a chemical compound with the molecular formula C6H3FINO2 and a molecular weight of 267.00 g/mol. IUPAC name: 4-fluoro-1-iodo-2-nitrobenzene. InChIKey: ANPFMDLUEWNKIM-UHFFFAOYSA-N.
| Molecular formula | C6H3FINO2 |
|---|---|
| Molecular weight | 267.00 g/mol |
| IUPAC name | 4-fluoro-1-iodo-2-nitrobenzene |
| InChIKey | ANPFMDLUEWNKIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])I |
Computed by PubChem (NCBI)