Products 1393569-15-7

CAS 1393569-15-7 is the registry number for 6-Fluoro-4-iodopicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-fluoro-4-iodopyridine-2-carboxylic acid (CAS 1393569-15-7) is a chemical compound with the molecular formula C6H3FINO2 and a molecular weight of 267.00 g/mol. IUPAC name: 6-fluoro-4-iodopyridine-2-carboxylic acid. InChIKey: DCVLQINNFIPBIV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3FINO2
Molecular weight267.00 g/mol
IUPAC name6-fluoro-4-iodopyridine-2-carboxylic acid
InChIKeyDCVLQINNFIPBIV-UHFFFAOYSA-N
SMILESC1=C(C=C(N=C1C(=O)O)F)I

Computed by PubChem (NCBI)