CAS 1261782-23-3 appears in our catalog under these names: 2–Fluoro–1–iodo–3–nitrobenzene, 2-Fluoro-1-iodo-3-nitrobenzene, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 50mg, 1g, 5g, 100mg, 250mg.
2-fluoro-1-iodo-3-nitrobenzene (CAS 1261782-23-3) is a chemical compound with the molecular formula C6H3FINO2 and a molecular weight of 267.00 g/mol. IUPAC name: 2-fluoro-1-iodo-3-nitrobenzene. InChIKey: WSBBGGJMXFKGAF-UHFFFAOYSA-N.
| Molecular formula | C6H3FINO2 |
|---|---|
| Molecular weight | 267.00 g/mol |
| IUPAC name | 2-fluoro-1-iodo-3-nitrobenzene |
| InChIKey | WSBBGGJMXFKGAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)