cas: 63059-29-0 — see every product listed under this CAS number, including other names
2-Iodobenzenesulfonyl Chloride, >98.0%(GC)(T) (CAS 63059-29-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0811-1G |
| cas | 63059-29-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 390.28 Pln | |
| TCI | 5g | 1118.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-iodobenzenesulfonyl chloride (CAS 63059-29-0) is a chemical compound with the molecular formula C6H4ClIO2S and a molecular weight of 302.52 g/mol. IUPAC name: 2-iodobenzenesulfonyl chloride. InChIKey: ZPNWNLNPDRYULE-UHFFFAOYSA-N.
| Molecular formula | C6H4ClIO2S |
|---|---|
| Molecular weight | 302.52 g/mol |
| IUPAC name | 2-iodobenzenesulfonyl chloride |
| InChIKey | ZPNWNLNPDRYULE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)Cl)I |
Computed by PubChem (NCBI)