cas: 63059-29-0 — see every product listed under this CAS number, including other names
2-Iodobenzenesulfonyl Chloride, 98%, 98% (CAS 63059-29-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HGQ-5g |
| cas | 63059-29-0 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1211.60 Pln | |
| Chemat | 25g | 4389.20 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 501.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-iodobenzenesulfonyl chloride (CAS 63059-29-0) is a chemical compound with the molecular formula C6H4ClIO2S and a molecular weight of 302.52 g/mol. IUPAC name: 2-iodobenzenesulfonyl chloride. InChIKey: ZPNWNLNPDRYULE-UHFFFAOYSA-N.
| Molecular formula | C6H4ClIO2S |
|---|---|
| Molecular weight | 302.52 g/mol |
| IUPAC name | 2-iodobenzenesulfonyl chloride |
| InChIKey | ZPNWNLNPDRYULE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)Cl)I |
Computed by PubChem (NCBI)