Products 98-61-3
CAS 98-61-3 appears in our catalog under these names: 4-Iodobenzene-1-sulfonyl chloride, 98%, Boc-D-Arg(Pbf)-OH, 98%, 4–Iodobenzenesulfonyl chloride, 4-Iodobenzenesulfonyl chloride, 97% , 4-Iodobenzenesulfonyl Chloride, >93.0%(T). Offered by: Fluorochem, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
4-iodobenzenesulfonyl chloride (CAS 98-61-3) is a chemical compound with the molecular formula C6H4ClIO2S and a molecular weight of 302.52 g/mol. IUPAC name: 4-iodobenzenesulfonyl chloride. InChIKey: POXFXTSTVWDWIR-UHFFFAOYSA-N.
| Molecular formula | C6H4ClIO2S |
|---|---|
| Molecular weight | 302.52 g/mol |
| IUPAC name | 4-iodobenzenesulfonyl chloride |
| InChIKey | POXFXTSTVWDWIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)Cl)I |
Computed by PubChem (NCBI)
Synonyms:
4-Iodobenzenesulfonyl chloride, Pipsyl chloride, Pipsyl choride, Benzenesulfonyl chloride, 4-iodo-, 4-Iodophenylsulfonyl Chloride, p-Iodophenylsulfonyl chloride, 4-iodobenzene-1-sulfonyl chloride, p-Iodobenzenesulfonyl chloride, 4-Iodobenzenesulphonyl chloride, Iodobenzene-p-sulfonyl chloride