cas: 95241-36-4 — see every product listed under this CAS number, including other names
2-Isopropoxyethyl Benzoate, 95%, 95% (CAS 95241-36-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HHF-250mg |
| cas | 95241-36-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 261.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-propan-2-yloxyethyl benzoate (CAS 95241-36-4) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-propan-2-yloxyethyl benzoate. InChIKey: QLSUGJQAAUGJHE-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2-propan-2-yloxyethyl benzoate |
| InChIKey | QLSUGJQAAUGJHE-UHFFFAOYSA-N |
| SMILES | CC(C)OCCOC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)