CAS 59012-91-8 appears in our catalog under these names: 4-(Hydroxymethyl)phenyl pivalate, 95%, 4–(Hydroxymethyl)phenyl pivalate, 4-(Hydroxymethyl)phenyl pivalate, 95%, 95%, 4-(Hydroxymethyl)phenol pivalate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 50mg, 5g.
[4-(hydroxymethyl)phenyl] 2,2-dimethylpropanoate (CAS 59012-91-8) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: [4-(hydroxymethyl)phenyl] 2,2-dimethylpropanoate. InChIKey: AYTDWGYFYZIASM-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | [4-(hydroxymethyl)phenyl] 2,2-dimethylpropanoate |
| InChIKey | AYTDWGYFYZIASM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)CO |
Computed by PubChem (NCBI)