CAS 56674-88-5 appears in our catalog under these names: methyl (1s,3R,5S,7s)-4-oxoadamantane-1-carboxylate, 95%, Methyl 4–oxoadamantane–1–carboxylate, 4-Oxo-adamantane-1-carboxylic acid methyl ester. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl 4-oxoadamantane-1-carboxylate (CAS 56674-88-5) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: methyl 4-oxoadamantane-1-carboxylate. InChIKey: DUPFRYAOGHZOCO-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | methyl 4-oxoadamantane-1-carboxylate |
| InChIKey | DUPFRYAOGHZOCO-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3CC(C1)C(=O)C(C3)C2 |
Computed by PubChem (NCBI)