cas: 76347-13-2 — see every product listed under this CAS number, including other names
2-Isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 76347-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160037-1g |
| cas | 76347-13-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 731.94 Pln | |
| Ambeed | 500g | 3363.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A160037 |
4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane (CAS 76347-13-2) is a chemical compound with the molecular formula C9H19BO2 and a molecular weight of 170.06 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane. InChIKey: MECCSFDHAVAAAW-UHFFFAOYSA-N.
| Molecular formula | C9H19BO2 |
|---|---|
| Molecular weight | 170.06 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
| InChIKey | MECCSFDHAVAAAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)C |
Computed by PubChem (NCBI)