cas: 76347-13-2 — see every product listed under this CAS number, including other names
2-Isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 76347-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HHL-1g |
| cas | 76347-13-2 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 208.40 Pln | |
| Chemat | 100g | 611.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane (CAS 76347-13-2) is a chemical compound with the molecular formula C9H19BO2 and a molecular weight of 170.06 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane. InChIKey: MECCSFDHAVAAAW-UHFFFAOYSA-N.
| Molecular formula | C9H19BO2 |
|---|---|
| Molecular weight | 170.06 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
| InChIKey | MECCSFDHAVAAAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)C |
Computed by PubChem (NCBI)