cas: 213381-88-5 — see every product listed under this CAS number, including other names
2-METHYL-4-(4'-TERT-BUTYLPHENYL)INDENE, 97%, 97% (CAS 213381-88-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1183OR-250mg |
| cas | 213381-88-5 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 875.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4-tert-butylphenyl)-2-methyl-1H-indene (CAS 213381-88-5) is a chemical compound with the molecular formula C20H22 and a molecular weight of 262.4 g/mol. IUPAC name: 4-(4-tert-butylphenyl)-2-methyl-1H-indene. InChIKey: FUDWOKXLGOJFFQ-UHFFFAOYSA-N.
| Molecular formula | C20H22 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)-2-methyl-1H-indene |
| InChIKey | FUDWOKXLGOJFFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C1)C=CC=C2C3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)