cas: 213381-88-5 — see every product listed under this CAS number, including other names
4-(4-(tert-Butyl)phenyl)-2-methyl-1H-indene 97% (CAS 213381-88-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A346851-250mg |
| cas | 213381-88-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1249.25 Pln | |
| Ambeed | 10g | 1955.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A346851 |
4-(4-tert-butylphenyl)-2-methyl-1H-indene (CAS 213381-88-5) is a chemical compound with the molecular formula C20H22 and a molecular weight of 262.4 g/mol. IUPAC name: 4-(4-tert-butylphenyl)-2-methyl-1H-indene. InChIKey: FUDWOKXLGOJFFQ-UHFFFAOYSA-N.
| Molecular formula | C20H22 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)-2-methyl-1H-indene |
| InChIKey | FUDWOKXLGOJFFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C1)C=CC=C2C3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)