cas: 22162-14-7 — see every product listed under this CAS number, including other names
2-METHYL-4-NITROBENZYL BROMIDE, 98% (CAS 22162-14-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F538866-250MG |
| cas | 22162-14-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1736.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(bromomethyl)-2-methyl-4-nitrobenzene (CAS 22162-14-7) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-(bromomethyl)-2-methyl-4-nitrobenzene. InChIKey: KEQVEPTWWMCODQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-(bromomethyl)-2-methyl-4-nitrobenzene |
| InChIKey | KEQVEPTWWMCODQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)