CAS 89694-10-0 appears in our catalog under these names: 2–Methoxy–3–methyl–5–nitropyridine, 2-Methoxy-3-methyl-5-nitropyridine, 98%, 98%, 2-Methoxy-3-methyl-5-nitropyridine, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
2-methoxy-3-methyl-5-nitropyridine (CAS 89694-10-0) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2-methoxy-3-methyl-5-nitropyridine. InChIKey: HEDKXDCXKNQWEX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-methoxy-3-methyl-5-nitropyridine |
| InChIKey | HEDKXDCXKNQWEX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)