Products 933694-89-4

CAS 933694-89-4 is the registry number for 2,4,6,7-Tetrahydro-pyrano[4,3-c]pyrazole-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid (CAS 933694-89-4) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid. InChIKey: YICMXCDJSOOXSM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O3
Molecular weight168.15 g/mol
IUPAC name1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylic acid
InChIKeyYICMXCDJSOOXSM-UHFFFAOYSA-N
SMILESC1COCC2=C1NN=C2C(=O)O

Computed by PubChem (NCBI)