CAS 14248-66-9 appears in our catalog under these names: 3,5-Dimethyl-4-nitropyridine 1-oxide, 95%, Esomeprazole Impurity 45 (4-Nitro-3, 5-Dimethylpyridine N-oxide), 3,5-Dimethyl-4-nitropyridine 1-Oxide, >95% (HPLC), 3,5-Dimethyl-4-nitropyridine 1-oxide, 3,5-Dimethyl-4-nitropyridine 1-oxide, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: 1g, 250mg, on request, 100mg, 10g, 5g, 25g, 50g.
3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium (CAS 14248-66-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: VLKVMXPKEDVNBO-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | VLKVMXPKEDVNBO-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=CC(=C1[N+](=O)[O-])C)[O-] |
Computed by PubChem (NCBI)