cas: 160590-36-3 — see every product listed under this CAS number, including other names
2-Methoxy-3-nitro-4-methylpyridine 98% (CAS 160590-36-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A204309-250mg |
| cas | 160590-36-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 25g | 592.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A204309 |
2-methoxy-4-methyl-3-nitropyridine (CAS 160590-36-3) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2-methoxy-4-methyl-3-nitropyridine. InChIKey: BGHDKUHZYJCOQG-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-methoxy-4-methyl-3-nitropyridine |
| InChIKey | BGHDKUHZYJCOQG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)