cas: 33623-16-4 — see every product listed under this CAS number, including other names
2-Methoxy-3-nitropyridin-4-amine, 98%, 98% (CAS 33623-16-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CB30-10g |
| cas | 33623-16-4 |
| size | 10g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2992.40 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 500mg | 424.40 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1802.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-3-nitropyridin-4-amine (CAS 33623-16-4) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: 2-methoxy-3-nitropyridin-4-amine. InChIKey: XADFTCGTAKIZMI-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | 2-methoxy-3-nitropyridin-4-amine |
| InChIKey | XADFTCGTAKIZMI-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)