cas: 1052686-60-8 — see every product listed under this CAS number, including other names
2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 99%, 99% (CAS 1052686-60-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119Z4A-100mg |
| cas | 1052686-60-8 |
| size | 100mg |
| availability | 9.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1634.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1052686-60-8) is a chemical compound with the molecular formula C11H17BN2O3 and a molecular weight of 236.08 g/mol. IUPAC name: 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: NPIOFBGJGBMTRC-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O3 |
|---|---|
| Molecular weight | 236.08 g/mol |
| IUPAC name | 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | NPIOFBGJGBMTRC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)OC |
Computed by PubChem (NCBI)