CAS 1787251-98-2 is the registry number for 5-Amino-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one (CAS 1787251-98-2) is a chemical compound with the molecular formula C11H17BN2O3 and a molecular weight of 236.08 g/mol. IUPAC name: 5-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one. InChIKey: HUDZNQXTCCOIIB-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O3 |
|---|---|
| Molecular weight | 236.08 g/mol |
| IUPAC name | 5-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one |
| InChIKey | HUDZNQXTCCOIIB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CNC2=O)N |
Computed by PubChem (NCBI)