CAS 2474024-05-8 is the registry number for 3-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine (CAS 2474024-05-8) is a chemical compound with the molecular formula C11H17BN2O3 and a molecular weight of 236.08 g/mol. IUPAC name: 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine. InChIKey: NXRATTINECRXBN-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O3 |
|---|---|
| Molecular weight | 236.08 g/mol |
| IUPAC name | 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine |
| InChIKey | NXRATTINECRXBN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN=C2)OC |
Computed by PubChem (NCBI)