cas: 99-59-2 — see every product listed under this CAS number, including other names
2-Methoxy-5-nitroaniline, 95% (CAS 99-59-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219388-5G |
| cas | 99-59-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 549.82 Pln | |
| Fluorochem | 500g | 2059.71 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-methoxy-5-nitroaniline is a substituted aniline and a member of 4-nitroanisoles.
Source: ChEBI
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-methoxy-5-nitroaniline |
| InChIKey | NIPDVSLAMPAWTP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)