2-Methoxy-6-nitrophenylamine, 98%
cas: 16554-45-3 — see every product listed under this CAS number, including other names
2-Methoxy-6-nitrophenylamine, 98% (CAS 16554-45-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A530186-1g |
| cas | 16554-45-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 1143.56 Pln | |
| Ambeed | 500g | 5332.12 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 236.61 Pln | |
| BLDpharm | 25g | 358.79 Pln | |
| BLDpharm | 100g | 1230.70 Pln | |
| BLDpharm | 500g | 5740.23 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-methoxy-6-nitroaniline (CAS 16554-45-3) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2-methoxy-6-nitroaniline. InChIKey: NDKWDGCTUOOAPF-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-methoxy-6-nitroaniline |
| InChIKey | NDKWDGCTUOOAPF-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1N)[N+](=O)[O-] |
Computed by PubChem (NCBI)